KL 001 structure
|
Common Name | KL 001 | ||
|---|---|---|---|---|
| CAS Number | 309928-48-1 | Molecular Weight | 398.475 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 578.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C21H22N2O4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 303.4±32.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of KL 001KL001 is a cryptochrome protein (CRY) stabilizer which specifically interacts with CRY1 and CRY2. KL001 prevents ubiquitin-dependent degradation of CRY, resulting in lengthening of the circadian period. KL001 has the potential to control fasting hormone-induced gluconeogenesis[1][2]. |
| Name | kl001 |
|---|---|
| Synonym | More Synonyms |
| Description | KL001 is a cryptochrome protein (CRY) stabilizer which specifically interacts with CRY1 and CRY2. KL001 prevents ubiquitin-dependent degradation of CRY, resulting in lengthening of the circadian period. KL001 has the potential to control fasting hormone-induced gluconeogenesis[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | KL001 (0.03-71 μM) causes circadian period lengthening and amplitude reduction in a dose-dependent manner in stable U2OS reporter cell lines harboring Bmal1-dLuc or Per2-dLuc[1]. KL001 (2-8 μM; 18 h) represses glucagon-dependent induction of Pck1 and G6pc genes in a dose-dependent manner without affecting their basal expression in mouse primary hepatocytes[1]. |
| References |
[2]. Kelleher FC, et, al. Circadian molecular clocks and cancer. Cancer Lett. 2014 Jan 1;342(1):9-18. |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 578.1±60.0 °C at 760 mmHg |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.475 |
| Flash Point | 303.4±32.9 °C |
| Exact Mass | 398.130035 |
| PSA | 84.06000 |
| LogP | 4.70 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | OQAFDLPAPSSOHY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N(Cc1ccco1)CC(O)Cn1c2ccccc2c2ccccc21 |
| Storage condition | 2-8°C |
| Methanesulfonamide, N-[3-(9H-carbazol-9-yl)-2-hydroxypropyl]-N-(2-furanylmethyl)- |
| N-[3-(9H-Carbazol-9-yl)-2-hydroxypropyl]-N-(2-furylmethyl)methanesulfonamide |
| N-(3-Carbazol-9-yl-2-hydroxy-propyl)-N-furan-2-ylmethyl-methanesulfonamide |