JNJ-2408068 structure
|
Common Name | JNJ-2408068 | ||
|---|---|---|---|---|
| CAS Number | 317846-22-3 | Molecular Weight | 394.51300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H30N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of JNJ-2408068JNJ 2408068 is a potent RSV (respiratory syncytial virus) inhibitor. JNJ 2408068 significantly inhibits replication of RSV A and B subtypes in the lungs of cotton rats without any evidence of toxicity. The minimum protective dose of JNJ 2408068 appears to be approximately 0.39 mg/kg[1]. |
| Name | 2-[[2-[[1-(2-aminoethyl)piperidin-4-yl]amino]-4-methylbenzimidazol-1-yl]methyl]-6-methylpyridin-3-ol |
|---|---|
| Synonym | More Synonyms |
| Description | JNJ 2408068 is a potent RSV (respiratory syncytial virus) inhibitor. JNJ 2408068 significantly inhibits replication of RSV A and B subtypes in the lungs of cotton rats without any evidence of toxicity. The minimum protective dose of JNJ 2408068 appears to be approximately 0.39 mg/kg[1]. |
|---|---|
| Related Catalog | |
| Target |
RSV-A RSV-B |
| References |
| Molecular Formula | C22H30N6O |
|---|---|
| Molecular Weight | 394.51300 |
| Exact Mass | 394.24800 |
| PSA | 95.46000 |
| LogP | 2.69710 |
| InChIKey | RDQSNNMSDOHAPG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(Cn2c(NC3CCN(CCN)CC3)nc3c(C)cccc32)n1 |
| unii-ab821dl88a |