2H-Isoindole-2-butanenitrile,1,3-dihydro-1,3-dioxo structure
|
Common Name | 2H-Isoindole-2-butanenitrile,1,3-dihydro-1,3-dioxo | ||
|---|---|---|---|---|
| CAS Number | 3184-61-0 | Molecular Weight | 214.22000 | |
| Density | 1.286g/cm3 | Boiling Point | 403.9ºC at 760mmHg | |
| Molecular Formula | C12H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.1ºC | |
| Name | 4-(1,3-dioxoisoindol-2-yl)butanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 403.9ºC at 760mmHg |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22000 |
| Flash Point | 198.1ºC |
| Exact Mass | 214.07400 |
| PSA | 61.17000 |
| LogP | 1.52428 |
| Index of Refraction | 1.589 |
| InChIKey | VORDNGFQVIFSBE-UHFFFAOYSA-N |
| SMILES | N#CCCCN1C(=O)c2ccccc2C1=O |
| HS Code | 2926909090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
| 4-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)butanenitrile |
| 4-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)butanenitrile |
| 4-Phthalimidobutyronitrile |
| N-(3-cyano-propyl)-phthalimide |
| 4-(1,3-dioxo-1,3-dihydroisoindol-2-yl)butyronitrile |