Maltoheptaose hydrate structure
|
Common Name | Maltoheptaose hydrate | ||
|---|---|---|---|---|
| CAS Number | 331748-09-5 | Molecular Weight | 1171.01 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H74O37 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Maltoheptaose hydrateMaltoheptaose hydrate is an activator of phosphorylase B to prepare heptulose-2-phosphate. Maltoheptaose hydrate is a maltooligosaccharide contanins seven glucose units[1][2]. |
| Name | Maltoheptaose hydrate |
|---|
| Description | Maltoheptaose hydrate is an activator of phosphorylase B to prepare heptulose-2-phosphate. Maltoheptaose hydrate is a maltooligosaccharide contanins seven glucose units[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Phosphorylase B |
| References |
| Molecular Formula | C42H74O37 |
|---|---|
| Molecular Weight | 1171.01 |
| InChIKey | WYYBIPDXMUDOHX-GEXPGIPISA-N |
| SMILES | O.O=CC(O)C(O)C(OC1OC(CO)C(OC2OC(CO)C(OC3OC(CO)C(OC4OC(CO)C(OC5OC(CO)C(OC6OC(CO)C(O)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O)C(O)C2O)C(O)C1O)C(O)CO |