benzyl dimethoxyphosphorylformate structure
|
Common Name | benzyl dimethoxyphosphorylformate | ||
|---|---|---|---|---|
| CAS Number | 33472-04-7 | Molecular Weight | 244.18100 | |
| Density | 1.248g/cm3 | Boiling Point | 345.7ºC at 760 mmHg | |
| Molecular Formula | C10H13O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.6ºC | |
| Name | benzyl dimethoxyphosphorylformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 345.7ºC at 760 mmHg |
| Molecular Formula | C10H13O5P |
| Molecular Weight | 244.18100 |
| Flash Point | 176.6ºC |
| Exact Mass | 244.05000 |
| PSA | 71.64000 |
| LogP | 2.80910 |
| Index of Refraction | 1.496 |
| InChIKey | XFKFJOZJWXBAPK-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)C(=O)OCc1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~87%
benzyl dimethox... CAS#:33472-04-7 |
| Literature: Astra Lakemedel Aktiebolag Patent: US4386081 A1, 1983 ; |
|
~92%
benzyl dimethox... CAS#:33472-04-7 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| dimethyl benzyloxycarbonylphosphonate |
| Phosphinecarboxylic acid,dimethoxy-,phenylmethyl ester,oxide |
| Dimethylcarbobenzoxyphosphonat |
| benzyl dimethoxyphosphinecarboxylate oxide |