diethyl 5-ethylpyridine-2,3-dicarboxylate structure
|
Common Name | diethyl 5-ethylpyridine-2,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 105151-39-1 | Molecular Weight | 251.27800 | |
| Density | 1.12g/cm3 | Boiling Point | 351.6ºC at 760mmHg | |
| Molecular Formula | C13H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.4ºC | |
| Name | diethyl 5-ethylpyridine-2,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 351.6ºC at 760mmHg |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.27800 |
| Flash Point | 166.4ºC |
| Exact Mass | 251.11600 |
| PSA | 65.49000 |
| LogP | 1.99740 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | VSPXTWXXNZJEHM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(CC)cnc1C(=O)OCC |
| Hazard Codes | F: Flammable; |
|---|---|
| HS Code | 2933399090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-Pyridinedicarboxylicacid,5-ethyl-,2,3-diethyl ester |
| diethyl ester of 5-ethylpyridine-2,3-dicarboxylic acid |
| 5-ethyl-2,3-pyridinedicarboxylic acid diethyl ester |
| diethyl 5-ethyl-2,3-pyridinedicarboxylate |
| 5-Ethylpyridine-2,3-dicarboxylic acid diethyl ester |
| MFCD06658212 |
| 5-ethyl-2,3-diethoxycarbonylpyridine |
| 5-ethylpyridine dicarboxylic acid,diethyl ester |