Peroxide,1,1-dimethylethyl 1-methyl-1-phenylethyl structure
|
Common Name | Peroxide,1,1-dimethylethyl 1-methyl-1-phenylethyl | ||
|---|---|---|---|---|
| CAS Number | 3457-61-2 | Molecular Weight | 208.29700 | |
| Density | 0.93 g/cm 3 | Boiling Point | 249.4ºC | |
| Molecular Formula | C13H20O2 | Melting Point | 6ºC | |
| MSDS | N/A | Flash Point | 75ºC | |
| Name | tert-butyl cumyl peroxide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.93 g/cm 3 |
|---|---|
| Boiling Point | 249.4ºC |
| Melting Point | 6ºC |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.29700 |
| Flash Point | 75ºC |
| Exact Mass | 208.14600 |
| PSA | 18.46000 |
| LogP | 3.66840 |
| Index of Refraction | 1.419-1.423 |
| InChIKey | BIISIZOQPWZPPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OOC(C)(C)c1ccccc1 |
| Hazard Codes | O;Xi;N |
|---|---|
| Risk Phrases | R7 |
| Safety Phrases | 61-36/37/39-3/7-14A-14 |
| RIDADR | UN3105 5.2/PG 2 |
| Packaging Group | II |
| Hazard Class | 5.2 |
| HS Code | 2909600000 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2909600000 |
|---|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| tert-butylcumeneperoxide |
| tert.-Butylcumylperoxid |
| Luperco 801-XL |
| Trigonox T |
| t-Butyl cumyl peroxide |
| MFCD00128882 |
| NA-2091 |
| tert-Butyl-(1-methyl-1-phenyl-aethyl)-peroxid |
| EINECS 222-389-8 |
| tert-butyl-(1-methyl-1-phenyl-ethyl)-peroxide |
| Butyl cumyl peroxide |
| Cumyl tert-butyl peroxide |
| Kayabutyl C |
| tert-butyl peroxide |
| 2-(t-butylperoxy)-2-phenylpropane |