1,1,1,2,3,3,3-heptafluoro-2-(trifluoromethyl)propane structure
|
Common Name | 1,1,1,2,3,3,3-heptafluoro-2-(trifluoromethyl)propane | ||
|---|---|---|---|---|
| CAS Number | 354-92-7 | Molecular Weight | 238.02700 | |
| Density | 1.595g/cm3 | Boiling Point | 2.1ºC at 760mmHg | |
| Molecular Formula | C4F10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,2,3,3,3-heptafluoro-2-(trifluoromethyl)propane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.595g/cm3 |
|---|---|
| Boiling Point | 2.1ºC at 760mmHg |
| Molecular Formula | C4F10 |
| Molecular Weight | 238.02700 |
| Exact Mass | 237.98400 |
| LogP | 3.38160 |
| Index of Refraction | 1.233 |
| InChIKey | COQIQRBKEGPRSG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2903399090 |
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| perfluoroisobutylene |
| Decafluoroisobutane |
| PERFLISOBUTANE |
| UNII-7W4TAI502Z |
| COQIQRBKEGPRSG-UHFFFAOYSA |
| Decafluoro-2-methylpropane |
| perfluoro-iso-butane |