2-Chloro-1-(2,4,6-trimethoxy-phenyl)-ethanone structure
|
Common Name | 2-Chloro-1-(2,4,6-trimethoxy-phenyl)-ethanone | ||
|---|---|---|---|---|
| CAS Number | 35543-30-7 | Molecular Weight | 244.67200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-1-(2,4,6-trimethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13ClO4 |
|---|---|
| Molecular Weight | 244.67200 |
| Exact Mass | 244.05000 |
| PSA | 44.76000 |
| LogP | 2.13390 |
| InChIKey | FGJFFNYREINBNT-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C(=O)CCl)c(OC)c1 |
| HS Code | 2914700090 |
|---|
|
~%
2-Chloro-1-(2,4... CAS#:35543-30-7 |
| Literature: Freudenberg; Fikentscher; Harder Justus Liebigs Annalen der Chemie, 1925 , vol. 441, p. 159,166 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Chlor-1-(2,4,6-trimethoxy-phenyl)-aethanon |
| 2-chloro-1-(2,4,6-trimethoxy-phenyl)-ethanone |
| T0518-0638 |