AG-09/1 structure
|
Common Name | AG-09/1 | ||
|---|---|---|---|---|
| CAS Number | 356776-32-4 | Molecular Weight | 358.37200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N4O4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
Use of AG-09/1AG-09/1 is a specific formyl peptide receptor 1 (FPR1) agonist. N-formyl peptide receptors (FPR) are important in host defense[1]. |
| Name | 2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | AG-09/1 is a specific formyl peptide receptor 1 (FPR1) agonist. N-formyl peptide receptors (FPR) are important in host defense[1]. |
|---|---|
| Related Catalog | |
| Target |
FPR1[1] |
| In Vitro | N-formyl peptides activate phagocytes through G protein-coupled receptors known as FPR. FPR1 was the first FPR cloned and encodes a high-affinity receptor for fMLF[1]. |
| References |
| Molecular Formula | C16H14N4O4S |
|---|---|
| Molecular Weight | 358.37200 |
| Exact Mass | 358.07400 |
| PSA | 138.13000 |
| LogP | 3.80670 |
| InChIKey | LYQDSNOFTIZWAX-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3)[nH]c2c1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| 2-[(6-methoxy-1H-benzimidazol-2-yl)thio]-N-(4-nitrophenyl)-acetamide |