Fmoc-Trp-OPfp structure
|
Common Name | Fmoc-Trp-OPfp | ||
|---|---|---|---|---|
| CAS Number | 86069-87-6 | Molecular Weight | 592.51200 | |
| Density | 1.452g/cm3 | Boiling Point | 755.2ºC at 760 mmHg | |
| Molecular Formula | C32H21F5N2O4 | Melting Point | 184-185℃ | |
| MSDS | Chinese USA | Flash Point | 410.5ºC | |
| Name | (2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.452g/cm3 |
|---|---|
| Boiling Point | 755.2ºC at 760 mmHg |
| Melting Point | 184-185℃ |
| Molecular Formula | C32H21F5N2O4 |
| Molecular Weight | 592.51200 |
| Flash Point | 410.5ºC |
| Exact Mass | 592.14200 |
| PSA | 80.42000 |
| LogP | 7.30970 |
| Index of Refraction | 1.631 |
| InChIKey | KLPGTAYCHANVFY-DEOSSOPVSA-N |
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)Oc1c(F)c(F)c(F)c(F)c1F)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~84%
Fmoc-Trp-OPfp CAS#:86069-87-6 |
| Literature: Kisfaludy, Lajos; Schoen, Istvan Synthesis, 1983 , # 4 p. 325 - 327 |
|
~95%
Fmoc-Trp-OPfp CAS#:86069-87-6 |
| Literature: Green, Michael; Berman, Judd Tetrahedron Letters, 1990 , vol. 31, # 41 p. 5851 - 5852 |
|
~%
Fmoc-Trp-OPfp CAS#:86069-87-6 |
| Literature: Synthesis, , # 4 p. 303 - 305 |
|
~%
Fmoc-Trp-OPfp CAS#:86069-87-6 |
| Literature: Synthesis, , # 4 p. 303 - 305 |
|
~%
Fmoc-Trp-OPfp CAS#:86069-87-6 |
| Literature: Tetrahedron Letters, , vol. 31, # 41 p. 5851 - 5852 |
| Fmoc-L-tryptophan pentafluorophenyl ester |
| MFCD00065681 |
| Fmoc-Trp-OC6F5 |
| Fmoc-Trp-OC6H5 |
| Fmoc-Trp-Pfp |
| Fmoc-Trp-OPfp |
| N-Fmoc-L-tryptophan pentafluorophenyl ester |