(S)-methyl 3-amino-2-(((benzyloxy)carbonyl)amino)propanoate hydrochloride structure
|
Common Name | (S)-methyl 3-amino-2-(((benzyloxy)carbonyl)amino)propanoate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 35761-27-4 | Molecular Weight | 288.72700 | |
| Density | 1.212g/cm3 | Boiling Point | 423.692ºC at 760 mmHg | |
| Molecular Formula | C12H17ClN2O4 | Melting Point | 157-162ºC dec. | |
| MSDS | N/A | Flash Point | 210.042ºC | |
Use of (S)-methyl 3-amino-2-(((benzyloxy)carbonyl)amino)propanoate hydrochloride3-Amino-N-(benzyloxycarbonyl)-L-alanine methyl ester hydrochloride is an alanine derivative[1]. |
| Name | Methyl 2-(S)-[N-Carbobenzyloxy]amino-3-aminopropionate, Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | 3-Amino-N-(benzyloxycarbonyl)-L-alanine methyl ester hydrochloride is an alanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 423.692ºC at 760 mmHg |
| Melting Point | 157-162ºC dec. |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.72700 |
| Flash Point | 210.042ºC |
| Exact Mass | 288.08800 |
| PSA | 90.65000 |
| LogP | 2.30630 |
| Index of Refraction | 1.537 |
| InChIKey | OLOFLUKZNNTGBC-PPHPATTJSA-N |
| SMILES | COC(=O)C(CN)NC(=O)OCc1ccccc1.Cl |
| Storage condition | Refrigerator |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| methyl (2S)-3-amino-2-(phenylmethoxycarbonylamino)propanoate,hydrochloride |