SMPH Crosslinker structure
|
Common Name | SMPH Crosslinker | ||
|---|---|---|---|---|
| CAS Number | 367927-39-7 | Molecular Weight | 379.36500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21N3O7 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of SMPH CrosslinkerSMPH Crosslinker is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | N-Succinimidyl 6-(3-Maleimidopropionamido) Hexanoate |
|---|---|
| Synonym | More Synonyms |
| Description | SMPH Crosslinker is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C17H21N3O7 |
|---|---|
| Molecular Weight | 379.36500 |
| Exact Mass | 379.13800 |
| PSA | 130.16000 |
| InChIKey | WCMOHMXWOOBVMZ-UHFFFAOYSA-N |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCCCCC(=O)ON1C(=O)CCC1=O |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2,5-dioxopyrrolidin-1-yl) 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate |