Aminopeptidase-IN-1 structure
|
Common Name | Aminopeptidase-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 374102-08-6 | Molecular Weight | 356.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Aminopeptidase-IN-1Aminopeptidase-IN-1 (compound 16o) is a potent insulin-regulated aminopeptidase (IRAP) inhibitor with an Ki value of 7.7 μM. Aminopeptidase-IN-1 can be used tor research cognitive and memory impairments[1]. |
| Name | Aminopeptidase-IN-1 |
|---|
| Description | Aminopeptidase-IN-1 (compound 16o) is a potent insulin-regulated aminopeptidase (IRAP) inhibitor with an Ki value of 7.7 μM. Aminopeptidase-IN-1 can be used tor research cognitive and memory impairments[1]. |
|---|---|
| Related Catalog | |
| Target |
Ki: 7.7 μM (IRAP)[1] |
| Molecular Formula | C18H16N2O6 |
|---|---|
| Molecular Weight | 356.33 |
| InChIKey | PHTAMBMUQWHXLX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N)Oc2cc(O)ccc2C1c1ccc([N+](=O)[O-])cc1 |