N-[(4-nitrophenyl)methylideneamino]methanamine structure
|
Common Name | N-[(4-nitrophenyl)methylideneamino]methanamine | ||
|---|---|---|---|---|
| CAS Number | 38127-55-8 | Molecular Weight | 179.17600 | |
| Density | 1.221g/cm3 | Boiling Point | 324.147ºC at 760 mmHg | |
| Molecular Formula | C8H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.839ºC | |
| Name | N-[(4-nitrophenyl)methylideneamino]methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 324.147ºC at 760 mmHg |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.17600 |
| Flash Point | 149.839ºC |
| Exact Mass | 179.06900 |
| PSA | 70.21000 |
| LogP | 2.06220 |
| Index of Refraction | 1.574 |
| InChIKey | OKMMMYIFTDKONT-UHFFFAOYSA-N |
| SMILES | CNN=Cc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2928000090 |
|---|
|
~%
N-[(4-nitrophen... CAS#:38127-55-8 |
| Literature: Brady; McHugh Journal of the Chemical Society, 1922 , vol. 121, p. 1651 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-nitrobenzaldehyde methylhydrazone |
| p-nitrobenzylidene methylhydrazine |
| p-Nitrobenzaldehyd-methylhydrazon |
| 4-Nitro-benzaldehyd-<methyl-hydrazon> |