YE 120 structure
|
Common Name | YE 120 | ||
|---|---|---|---|---|
| CAS Number | 383124-82-1 | Molecular Weight | 330.16800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H9Cl2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of YE 120YE120 is a potent GPR35 agonist with an EC50 of 32.5 nM[1]. |
| Name | [3-Cyano-5-(3,4-dichlorophenyl)-4,5-dimethyl-2(5H)-furanylidene]m alononitrile |
|---|---|
| Synonym | More Synonyms |
| Description | YE120 is a potent GPR35 agonist with an EC50 of 32.5 nM[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H9Cl2N3O |
|---|---|
| Molecular Weight | 330.16800 |
| Exact Mass | 329.01200 |
| PSA | 80.60000 |
| LogP | 4.38014 |
| InChIKey | RSWZFAPYKOARNG-UHFFFAOYSA-N |
| SMILES | CC1=C(C#N)C(=C(C#N)C#N)OC1(C)c1ccc(Cl)c(Cl)c1 |
|
~26%
YE 120 CAS#:383124-82-1 |
| Literature: Deng, Huayun; Fang, Ye; He, Mingqian; Hu, Haibei; Niu, Weijun; Sun, Haiyan Patent: US2012/22116 A1, 2012 ; Location in patent: Page/Page column 53 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Dicyanmethylen-3-cyan-4,6-dimethyl-1,2-dihydro-pyridin |
| 1,2-Dihydro-2-dicyanmethylen-3-cyan-4,6-dimethylpyridin |
| 3-cyano-2-dicyanomethylene-4,6-dimethyl-1,2-dihydropyridine |
| Fatostatin A |