2,6-Di-tert-butylnaphthalene
2,6-Di-tert-butylnaphthalene structure
|
Common Name | 2,6-Di-tert-butylnaphthalene | ||
|---|---|---|---|---|
| CAS Number | 3905-64-4 | Molecular Weight | 240.38300 | |
| Density | 0.935 g/cm3 | Boiling Point | 335.1ºC at 760 mmHg | |
| Molecular Formula | C18H24 | Melting Point | 148°C | |
| MSDS | N/A | Flash Point | 165.2ºC | |
Summary: 2,6-Di-tert-butylnaphthalene (CAS: 3905-64-4, molecular formula: C18H24, molecular weight: 240.38300), has a melting point of 148°C and a boiling point of 335.1°C (760 mmHg), with a density of 0.935 g/cm³. It is used as an intermediate for the non-anesthetic strong expectorant cough宁，仅供科研实验使用，不用于医疗或临床用途。
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-Di-tert-butylnaphthalene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.935 g/cm3 |
|---|---|
| Boiling Point | 335.1ºC at 760 mmHg |
| Melting Point | 148°C |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.38300 |
| Flash Point | 165.2ºC |
| Exact Mass | 240.18800 |
| LogP | 5.43480 |
| Index of Refraction | 1.542 |
| InChIKey | TZGXZNWUOXLMFL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2cc(C(C)(C)C)ccc2c1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2902909090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 10 | |
CAS#:91-20-3
CAS#:507-20-0
CAS#:75-65-0
CAS#:75-85-4
CAS#:1634-04-4
CAS#:6163-66-2
CAS#:75-28-5
CAS#:598-75-4
CAS#:78-83-1
CAS#:115-11-7
CAS#:32703-79-0
CAS#:14236-13-6
CAS#:7351-74-8
CAS#:31592-22-0![Benzo[c]picene structure](https://image.chemsrc.com/caspic/340/217-37-8.png)
CAS#:217-37-8
CAS#:47486-75-9
CAS#:61357-46-8
CAS#:61357-48-0
CAS#:61357-49-1
CAS#:54532-93-3This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00004110 |
| 2,6-ditert-butylnaphthalene |
| EINECS 223-461-1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,6-Di-tert-butylnaphthalene? |
| A: CAS number of 2,6-Di-tert-butylnaphthalene is 3905-64-4. |
| Q: What is the boiling point of 2,6-Di-tert-butylnaphthalene? |
| A: Boiling point of 2,6-Di-tert-butylnaphthalene is 335.1ºC at 760 mmHg. |
| Q: What English synonyms does 2,6-Di-tert-butylnaphthalene have? |
| A: English synonyms of 2,6-Di-tert-butylnaphthalene: MFCD00004110, 2,6-ditert-butylnaphthalene, EINECS 223-461-1. |
| Q: What is the English name of 2,6-Di-tert-butylnaphthalene? |
| A: The English name of 2,6-Di-tert-butylnaphthalene is 2,6-Di-tert-butylnaphthalene. |
| Q: What is the SMILES notation of 2,6-Di-tert-butylnaphthalene? |
| A: SMILES notation of 2,6-Di-tert-butylnaphthalene is CC(C)(C)c1ccc2cc(C(C)(C)C)ccc2c1. |
| Q: What is the molecular weight of 2,6-Di-tert-butylnaphthalene? |
| A: Molecular weight of 2,6-Di-tert-butylnaphthalene is 240.38300. |
| Q: What is the LogP of 2,6-Di-tert-butylnaphthalene? |
| A: LogP of 2,6-Di-tert-butylnaphthalene is 5.43480. |
| Q: What is the molecular formula of 2,6-Di-tert-butylnaphthalene? |
| A: Molecular formula of 2,6-Di-tert-butylnaphthalene is C18H24. |
| Q: What is the InChIKey of 2,6-Di-tert-butylnaphthalene? |
| A: InChIKey of 2,6-Di-tert-butylnaphthalene is TZGXZNWUOXLMFL-UHFFFAOYSA-N. |
| Q: What is the melting point of 2,6-Di-tert-butylnaphthalene? |
| A: Melting point of 2,6-Di-tert-butylnaphthalene is 148°C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |