GS 39783 structure
|
Common Name | GS 39783 | ||
|---|---|---|---|---|
| CAS Number | 39069-52-8 | Molecular Weight | 337.44000 | |
| Density | 1.3g/cm3 | Boiling Point | 561.9ºC at 760 mmHg | |
| Molecular Formula | C15H23N5O2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 293.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of GS 39783GS39783 is a positive allosteric modulator (PAM) of GABABR. Positive modulation of the GABABR can be used for the research of Nicotine addiction[1]. |
| Name | 4-N,6-N-dicyclopentyl-2-methylsulfanyl-5-nitropyrimidine-4,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Description | GS39783 is a positive allosteric modulator (PAM) of GABABR. Positive modulation of the GABABR can be used for the research of Nicotine addiction[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 561.9ºC at 760 mmHg |
| Molecular Formula | C15H23N5O2S |
| Molecular Weight | 337.44000 |
| Flash Point | 293.7ºC |
| Exact Mass | 337.15700 |
| PSA | 120.96000 |
| LogP | 4.48490 |
| Index of Refraction | 1.614 |
| InChIKey | GSGVDKOCBKBMGG-UHFFFAOYSA-N |
| SMILES | CSc1nc(NC2CCCC2)c([N+](=O)[O-])c(NC2CCCC2)n1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P301 + P312 + P330-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| Tocris-2001 |
| N,N'-dicyclopentyl-2-methylsulfanyl-5-nitropyrimidine-4,6-diamine |
| N4,N6-dicyclopentyl-2-methylsulfanyl-5-nitro-pyrimidine-4,6-diamine |