2-(3-chlorophenyl)-5-methylpyrazol-3-amine structure
|
Common Name | 2-(3-chlorophenyl)-5-methylpyrazol-3-amine | ||
|---|---|---|---|---|
| CAS Number | 40401-41-0 | Molecular Weight | 207.65900 | |
| Density | 1.32 | Boiling Point | 371.2ºC | |
| Molecular Formula | C10H10ClN3 | Melting Point | 139-140ºC | |
| MSDS | USA | Flash Point | 178.3ºC | |
| Name | 2-(3-chlorophenyl)-5-methylpyrazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32 |
|---|---|
| Boiling Point | 371.2ºC |
| Melting Point | 139-140ºC |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.65900 |
| Flash Point | 178.3ºC |
| Exact Mass | 207.05600 |
| PSA | 43.84000 |
| LogP | 2.99750 |
| Index of Refraction | 1.643 |
| InChIKey | YQXLXMSDCGPOLM-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)n(-c2cccc(Cl)c2)n1 |
| Hazard Codes | Xi |
|---|
|
~65%
2-(3-chlorophen... CAS#:40401-41-0 |
| Literature: Marinozzi, Maura; Marcelli, Gloria; Carotti, Andrea; Natalini, Benedetto RSC Advances, 2014 , vol. 4, # 14 p. 7019 - 7023 |
|
~%
2-(3-chlorophen... CAS#:40401-41-0 |
| Literature: Ochiai, Hiroshi; Ishida, Akiharu; Ohtani, Tazumi; Kusumi, Kensuke; Kishikawa, Katuya; Yamamoto, Susumu; Takeda, Hiroshi; Obata, Takaaki; Nakai, Hisao; Toda, Masaaki Chemical and Pharmaceutical Bulletin, 2004 , vol. 52, # 9 p. 1098 - 1104 |
|
~%
2-(3-chlorophen... CAS#:40401-41-0 |
| Literature: Kurtz et al. Justus Liebigs Annalen der Chemie, 1959 , vol. 624, p. 1,19 |
|
~%
2-(3-chlorophen... CAS#:40401-41-0 |
| Literature: Volochnyuk, Dmitriy M.; Ryabukhin, Sergey V.; Plaskon, Andrey S.; Dmytriv, Yuri V.; Grygorenko, Oleksandr O.; Mykhailiuk, Pavel K.; Krotko, Dmitriy G.; Pushechnikov, Alexei; Tolmachev, Andrey A. Journal of Combinatorial Chemistry, 2010 , vol. 12, # 4 p. 510 - 517 |
| 2-(3-Chlor-phenyl)-5-methyl-2H-pyrazol-3-ylamin |
| 5-amino-1-(3-chlorophenyl)-3-methylpyrazole |
| 2-(2,4-DIMETHYLPHENYL)-6,8-DIMETHYLQUINOLINE-4-CARBOXYLIC ACID |
| 3-methyl-1-(3-chlorophenyl)-1H-5-pyrazolamine |
| 5-Amino-3-methyl-1-(3-chlorophenyl)pyrazole |
| 1-(3-chlorophenyl)-3-methylpyrazole-5-ylamine |
| 1-(3-chlorophenyl)-3-methyl-1H-pyrazol-5-amine |
| 2-(3-Chloro-phenyl)-5-methyl-2H-pyrazol-3-ylamine |