phenyl 4-methoxybenzoate structure
|
Common Name | phenyl 4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 4181-97-9 | Molecular Weight | 228.24300 | |
| Density | 1.159g/cm3 | Boiling Point | 367.7ºC at 760 mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.9ºC | |
| Name | phenyl 4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 367.7ºC at 760 mmHg |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Flash Point | 153.9ºC |
| Exact Mass | 228.07900 |
| PSA | 35.53000 |
| LogP | 2.91440 |
| Index of Refraction | 1.569 |
| InChIKey | BNZYBNYNPXKWCM-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Oc2ccccc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 4-phenyl-4'-methoxybenzoate |
| phenyl-4-methoxybenzoate |
| phenyl anisate |
| Benzoic acid,4-methoxy-,phenyl ester |
| p-Anisic acid,phenyl ester |
| 4-Methoxy-benzoic acid phenyl ester |
| phenyl p-methoxybenzoate |
| p-Methoxybenzoic acid,phenyl ester |