1-Chloro-4H-octafluorobutane structure
|
Common Name | 1-Chloro-4H-octafluorobutane | ||
|---|---|---|---|---|
| CAS Number | 423-31-4 | Molecular Weight | 236.49100 | |
| Density | 1.576 g/cm3 | Boiling Point | 50 °C | |
| Molecular Formula | C4HClF8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Chloro-4H-octafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.576 g/cm3 |
|---|---|
| Boiling Point | 50 °C |
| Molecular Formula | C4HClF8 |
| Molecular Weight | 236.49100 |
| Exact Mass | 235.96400 |
| LogP | 3.35370 |
| Vapour Pressure | 289mmHg at 25°C |
| Index of Refraction | 1.283 |
| InChIKey | NNMVWNQEVYZFRC-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2903799090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1-chloro-1,1,2,2,3,3,4,4-octafluorobutane |
| MFCD00155682 |