4-(4-Bromo-phenyl)-1H-imidazole-2-thiol structure
|
Common Name | 4-(4-Bromo-phenyl)-1H-imidazole-2-thiol | ||
|---|---|---|---|---|
| CAS Number | 436095-86-2 | Molecular Weight | 255.13400 | |
| Density | 1.72g/cm3 | Boiling Point | 347.2ºC at 760 mmHg | |
| Molecular Formula | C9H7BrN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.8ºC | |
| Name | 4-(4-Bromo-phenyl)-1H-imidazole-2-thiol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 347.2ºC at 760 mmHg |
| Molecular Formula | C9H7BrN2S |
| Molecular Weight | 255.13400 |
| Flash Point | 163.8ºC |
| Exact Mass | 253.95100 |
| PSA | 67.48000 |
| LogP | 3.12790 |
| Index of Refraction | 1.754 |
| InChIKey | DJHSGVUEJWOYDR-UHFFFAOYSA-N |
| SMILES | S=c1[nH]cc(-c2ccc(Br)cc2)[nH]1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933290090 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-bromophenyl)-1,3-dihydroimidazole-2-thione |