KRM-III structure
|
Common Name | KRM-III | ||
|---|---|---|---|---|
| CAS Number | 79220-94-3 | Molecular Weight | 252.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of KRM-IIIKRM-III is a potent and orally active T-cell antigen receptor (TCR) inhibitor. KRM-III inhibits TCR- and phorbol myristate acetate/ionomycin-induced activation of nuclear factor of activated T cells (NFAT) and T-cell proliferation with an IC50 of ~5 μM. Anti-inflammatory activity[1]. |
| Name | 3,5-diphenyl-1H-imidazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Description | KRM-III is a potent and orally active T-cell antigen receptor (TCR) inhibitor. KRM-III inhibits TCR- and phorbol myristate acetate/ionomycin-induced activation of nuclear factor of activated T cells (NFAT) and T-cell proliferation with an IC50 of ~5 μM. Anti-inflammatory activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H12N2S |
|---|---|
| Molecular Weight | 252.33400 |
| Exact Mass | 252.07200 |
| PSA | 56.62000 |
| LogP | 3.82800 |
| InChIKey | QKOAQVKXZJFMET-UHFFFAOYSA-N |
| SMILES | S=c1[nH]c(-c2ccccc2)cn1-c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| 1,4-diphenyl-1H-imidazole-2-thiol |
| KRM-III |
| 1,4-phenyl-1H-imidazole-2-thiol |