SF 11
Modify Date: 2025-08-25 11:34:55
SF 11 structure
|
Common Name | SF 11 | ||
|---|---|---|---|---|
| CAS Number | 443292-81-7 | Molecular Weight | 446.60400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H30N2O2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of SF 11SF 11 is a potent and brain penetrant neuropeptide Y Y2 receptor antagonist (IC50=199 nM). Antidepressant-like activity[1][2]. |
| Name | N-(4-ethoxyphenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide |
|---|---|
| Synonym | More Synonyms |
| Description | SF 11 is a potent and brain penetrant neuropeptide Y Y2 receptor antagonist (IC50=199 nM). Antidepressant-like activity[1][2]. |
|---|---|
| Related Catalog | |
| Target |
NPYY2 receptor:199 nM (IC50) |
| References |
| Molecular Formula | C27H30N2O2S |
|---|---|
| Molecular Weight | 446.60400 |
| Exact Mass | 446.20300 |
| PSA | 76.82000 |
| LogP | 5.44110 |
| InChIKey | PMEQBGAGFZDWQX-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NC(=S)N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
|
Selective and brain penetrant neuropeptide y y2 receptor antagonists discovered by whole-cell high-throughput screening.
Mol. Pharmacol. , (2009) The role of neuropeptide Y Y2 receptor (Y2R) in human diseases such as obesity, mood disorders, and alcoholism could be better resolved by the use of small-molecule chemical probes that are substantia... |
| HMS2560N17 |
| N-(4-Ethoxyphenyl)-4-(hydroxydiphenylmethyl)-1-piperidinecarbothioamide SID 17507305 |