ML148 structure
|
Common Name | ML148 | ||
|---|---|---|---|---|
| CAS Number | 451496-96-1 | Molecular Weight | 319.40 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 543.4±52.0 °C at 760 mmHg | |
| Molecular Formula | C20H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.5±30.7 °C | |
Use of ML148ML148 is a potent and selective 15-PGDH inhibitor with an IC50 of 56 nM. ML148 has the potential for the research of prostaglandin-signaling pathways[1]. |
| Name | [1-(3-methylphenyl)-5-benzimidazolyl]-(1-piperidinyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Description | ML148 is a potent and selective 15-PGDH inhibitor with an IC50 of 56 nM. ML148 has the potential for the research of prostaglandin-signaling pathways[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 56 nM (15-PGDH)[1] |
| In Vitro | ML148 (compound 13) shows selectivity with IC50s of 56, 36000, >57500, >57500 nM for 15-PGDH, ALDH1A1, HADH2, HSD17β4, respectively[1]. ML148 (10, 20 nM) decrease Vmax by 25% and reduces the apparent Km by half at a concentration of 10 nM[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 543.4±52.0 °C at 760 mmHg |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.40 |
| Flash Point | 282.5±30.7 °C |
| Exact Mass | 319.168457 |
| LogP | 3.31 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | YQNOQZALLOQMPY-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-n2cnc3cc(C(=O)N4CCCCC4)ccc32)c1 |
| Storage condition | -20°C |
| [1-(3-Methylphenyl)-1H-benzimidazol-5-yl](1-piperidinyl)methanone |
| Methanone, [1-(3-methylphenyl)-1H-benzimidazol-5-yl]-1-piperidinyl- |
| [1-(3-methylphenyl)-5-benzimidazolyl]-(1-piperidinyl)methanone |
| 1-(3-methylphenyl)-5-(piperidin-1-ylcarbonyl)-1H-benzimidazole |