4,4'-Dithiobis[2-aminobutyric Acid] structure
|
Common Name | 4,4'-Dithiobis[2-aminobutyric Acid] | ||
|---|---|---|---|---|
| CAS Number | 462-10-2 | Molecular Weight | 268.354 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 507.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C8H16N2O4S2 | Melting Point | 281-284ºC (dec.) | |
| MSDS | N/A | Flash Point | 260.8±30.1 °C | |
| Name | homocystine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 507.6±50.0 °C at 760 mmHg |
| Melting Point | 281-284ºC (dec.) |
| Molecular Formula | C8H16N2O4S2 |
| Molecular Weight | 268.354 |
| Flash Point | 260.8±30.1 °C |
| Exact Mass | 268.055145 |
| PSA | 177.24000 |
| LogP | 1.03 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | ZTVZLYBCZNMWCF-UHFFFAOYSA-N |
| SMILES | NC(CCSSCCC(N)C(=O)O)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S22-S24/25 |
|
Name: Detoxification of acetaldehyde in aldehyde dehydrogenase inhibitor disuifiram/ethanol...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3279854
|
|
Name: Inhibition of human BHMT at 20 uM
Source: ChEMBL
Target: Betaine--homocysteine S-methyltransferase 1
External Id: CHEMBL865951
|
|
Name: Inhibition of human BHMT at 1 uM
Source: ChEMBL
Target: Betaine--homocysteine S-methyltransferase 1
External Id: CHEMBL865952
|
|
Name: Inhibition of human BHMT
Source: ChEMBL
Target: Betaine--homocysteine S-methyltransferase 1
External Id: CHEMBL865953
|
| L-4,4'-dithio-bis(2-aminobutanoic acid) |
| L-Homocystine |
| 4,4'-dithiobis[2-amino-Butanoic acid] |
| 4,4'-Disulfanediylbis(2-aminobutanoic acid) |
| 4,4-Dithiobis[2-Aminobutyric] Acid |
| 4,4'-Disulfanediylbis(2-aminobutansäure) |
| 4,4'-dithiobis[2-aminobutyric] acid |
| 4,4'-Dithiobis[2-aminobutanoic Acid] |
| 4,4-Dithiobis[2-Amino-Butanoic Acid] |
| 4,4'-Dithiobis[2-aminobutyric Acid] |
| L-4,4'-Dithiobis(2-aminobutyric acid) |
| homocystine |
| DL-Homocystine |