4,4'-Dithiobis[2-aminobutyric Acid]
![4,4'-Dithiobis[2-aminobutyric Acid] Structure](https://image.chemsrc.com/caspic/253/462-10-2.png)
4,4'-Dithiobis[2-aminobutyric Acid] structure
|
Common Name | 4,4'-Dithiobis[2-aminobutyric Acid] | ||
|---|---|---|---|---|
| CAS Number | 462-10-2 | Molecular Weight | 268.354 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 507.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C8H16N2O4S2 | Melting Point | 281-284ºC (dec.) | |
| MSDS | N/A | Flash Point | 260.8±30.1 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | homocystine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 507.6±50.0 °C at 760 mmHg |
| Melting Point | 281-284ºC (dec.) |
| Molecular Formula | C8H16N2O4S2 |
| Molecular Weight | 268.354 |
| Flash Point | 260.8±30.1 °C |
| Exact Mass | 268.055145 |
| PSA | 177.24000 |
| LogP | 1.03 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | ZTVZLYBCZNMWCF-UHFFFAOYSA-N |
| SMILES | NC(CCSSCCC(N)C(=O)O)C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S22-S24/25 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 7 | |
CAS#:1017-76-1
CAS#:10593-85-8
CAS#:454-29-5
CAS#:504-33-6
CAS#:123-41-1
CAS#:62-49-7
CAS#:60175-95-3This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Detoxification of acetaldehyde in aldehyde dehydrogenase inhibitor disuifiram/ethanol...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3279854
|
|
Name: Inhibition of human BHMT at 20 uM
Source: ChEMBL
Target: Betaine--homocysteine S-methyltransferase 1
External Id: CHEMBL865951
|
|
Name: Inhibition of human BHMT at 1 uM
Source: ChEMBL
Target: Betaine--homocysteine S-methyltransferase 1
External Id: CHEMBL865952
|
|
Name: Inhibition of human BHMT
Source: ChEMBL
Target: Betaine--homocysteine S-methyltransferase 1
External Id: CHEMBL865953
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| L-4,4'-dithio-bis(2-aminobutanoic acid) |
| L-Homocystine |
| 4,4'-dithiobis[2-amino-Butanoic acid] |
| 4,4'-Disulfanediylbis(2-aminobutanoic acid) |
| 4,4-Dithiobis[2-Aminobutyric] Acid |
| 4,4'-Disulfanediylbis(2-aminobutansäure) |
| 4,4'-dithiobis[2-aminobutyric] acid |
| 4,4'-Dithiobis[2-aminobutanoic Acid] |
| 4,4-Dithiobis[2-Amino-Butanoic Acid] |
| 4,4'-Dithiobis[2-aminobutyric Acid] |
| L-4,4'-Dithiobis(2-aminobutyric acid) |
| homocystine |
| DL-Homocystine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of homocystine? |
| A: Molecular weight of homocystine is 268.354. |
| Q: What is the CAS number of homocystine? |
| A: CAS number of homocystine is 462-10-2. |
| Q: What is the InChIKey of homocystine? |
| A: InChIKey of homocystine is ZTVZLYBCZNMWCF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of homocystine? |
| A: SMILES notation of homocystine is NC(CCSSCCC(N)C(=O)O)C(=O)O. |
| Q: What is the LogP of homocystine? |
| A: LogP of homocystine is 1.03. |
| Q: What are the downstream products of homocystine? |
| A: Related downstream products(CAS) of homocystine: 1017-76-1;10593-85-8;454-29-5;504-33-6;123-41-1;62-49-7;60175-95-3. |
| Q: What is the English name of homocystine? |
| A: The English name of homocystine is homocystine. |
| Q: What is the polar surface area (PSA) of homocystine? |
| A: Polar surface area (PSA) of homocystine is 177.24000. |
| Q: What is the safety information for homocystine? |
| A: Safety information for homocystine: S22-S24/25. |
| Q: What is the boiling point of homocystine? |
| A: Boiling point of homocystine is 507.6±50.0 °C at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |