Z-Glu(OMe)-OH structure
|
Common Name | Z-Glu(OMe)-OH | ||
|---|---|---|---|---|
| CAS Number | 4652-65-7 | Molecular Weight | 295.288 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 510.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C14H17NO6 | Melting Point | 70 °C | |
| MSDS | N/A | Flash Point | 262.6±30.1 °C | |
| Name | 5-methoxy-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 510.6±50.0 °C at 760 mmHg |
| Melting Point | 70 °C |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.288 |
| Flash Point | 262.6±30.1 °C |
| Exact Mass | 295.105591 |
| PSA | 101.93000 |
| LogP | 2.20 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | JSNVOAWDAFVIKY-NSHDSACASA-N |
| SMILES | COC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Methyl N-Carbobenzoxy-L-glutaMate |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-5-methoxy-5-oxopentanoic acid |
| (S)-2-(((Benzyloxy)carbonyl)amino)-5-methoxy-5-oxopentanoic acid |
| L-Glutamic acid, N-[(phenylmethoxy)carbonyl]-, 5-methyl ester |
| N-Carbobenzoxy-L-glutamic Acid 5-Methyl Ester |
| N-Cbz-L-glutamic Acid 5-Methyl Ester |
| Z-L-GLUTAMIC ACID Y-METHYLESTER |
| Cbz-L-glutamicacid4-methylester |
| 5-Methyl N-Cbz-L-glutamate |
| 2-benzyloxycarbonylaminopentanedioic acid 5-methyl ester |
| Z-Glu(Ome)-OH |
| CBZ-GLU(OME)-OH |