Uridine,2'-chloro-2'-deoxy- structure
|
Common Name | Uridine,2'-chloro-2'-deoxy- | ||
|---|---|---|---|---|
| CAS Number | 4753-04-2 | Molecular Weight | 262.65 | |
| Density | 1.67g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H11ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Uridine,2'-chloro-2'-deoxy-2′-Chloro-2′-deoxyuridine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 2'-chloro-2'-deoxyuridine |
|---|---|
| Synonym | More Synonyms |
| Description | 2′-Chloro-2′-deoxyuridine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.67g/cm3 |
|---|---|
| Molecular Formula | C9H11ClN2O5 |
| Molecular Weight | 262.65 |
| Exact Mass | 262.03600 |
| PSA | 104.55000 |
| Index of Refraction | 1.643 |
| InChIKey | XOTUXDQKWDTKSI-XVFCMESISA-N |
| SMILES | O=c1ccn(C2OC(CO)C(O)C2Cl)c(=O)[nH]1 |
| Storage condition | -20°C |
| Hazard Codes | Xn |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 2-CHLORO-2-DEOXYURIDINE |
| MFCD00057379 |
| 2'-Chlor-2'-deoxy-uridin |
| 2'-chloro-dU |
| 2'-Chlor-2'-desoxyuridin |
| 2'-Chloro-2'-deoxy-uridin |