Benzyl-PEG4-MS structure
|
Common Name | Benzyl-PEG4-MS | ||
|---|---|---|---|---|
| CAS Number | 477781-69-4 | Molecular Weight | 362.438 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 497.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C16H26O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.5±27.3 °C | |
Use of Benzyl-PEG4-MSBenzyl-PEG4-MS is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1-Phenyl-2,5,8,11-tetraoxatridecan-13-yl methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Benzyl-PEG4-MS is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 497.1±40.0 °C at 760 mmHg |
| Molecular Formula | C16H26O7S |
| Molecular Weight | 362.438 |
| Flash Point | 254.5±27.3 °C |
| Exact Mass | 362.139923 |
| LogP | 0.42 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | DAODDIFNUYIKRO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCOCCOCCOCCOCc1ccccc1 |
| 1-Phenyl-2,5,8,11-tetraoxatridecan-13-yl methanesulfonate |
| 2,5,8,11-Tetraoxatridecan-13-ol, 1-phenyl-, methanesulfonate |
| Benzyl-PEG4-MS |