Nobiletin structure
|
Common Name | Nobiletin | ||
|---|---|---|---|---|
| CAS Number | 478-01-3 | Molecular Weight | 402.395 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 587.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H22O8 | Melting Point | 138 °C | |
| MSDS | Chinese USA | Flash Point | 256.5±30.2 °C | |
Use of NobiletinNobiletin is a citrus flavonoid with anti-inflammatory, anti-cancer, cholesterol lowering, memory protection activities. |
| Name | nobiletin |
|---|---|
| Synonym | More Synonyms |
| Description | Nobiletin is a citrus flavonoid with anti-inflammatory, anti-cancer, cholesterol lowering, memory protection activities. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 587.9±50.0 °C at 760 mmHg |
| Melting Point | 138 °C |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.395 |
| Flash Point | 256.5±30.2 °C |
| Exact Mass | 402.131470 |
| PSA | 85.59000 |
| LogP | 2.48 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | MRIAQLRQZPPODS-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)c(OC)c3o2)cc1OC |
| Storage condition | -20°C |
| Stability | Stable, but unstable if heated rapidly. Combustible. Incompatible with strong oxidizing agents, powdered aluminium, potassium. |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| 2-(3,4-Dimethoxyphenyl)-5,6,7,8-tetramethoxy-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-5,6,7,8-tetramethoxy- |
| Flavone, 5,6,7,8,3',4'-hexamethoxy |
| Nobiletin,Hexamethoxyflavone |
| 2-(3,4-dimethoxyphenyl)-5,6,7,8-tetramethoxychromen-4-one |
| Nobiletin |
| 3',4',5,6,7,8-hexamethoxy-flavone |
| 5,6,7,8,3',4'-Hexamethoxyflavone |
| 3',4',5,6,7,8-Hexamethoxyflavone |
| Hexamethoxyflavone |
| MFCD03273560 |
| 2-(3,4-dimethoxy-phenyl)-5,6,7,8-tetramethoxy-chromen-4-one |