Corticosterone structure
|
Common Name | Corticosterone | ||
|---|---|---|---|---|
| CAS Number | 50-22-6 | Molecular Weight | 346.461 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 529.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H30O4 | Melting Point | 179-183 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 288.0±26.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of CorticosteroneCorticosterone is an adrenocortical steroid that has modest but significant activities as a mineralocorticoid and a glucocorticoid. |
| Name | corticosterone |
|---|---|
| Synonym | More Synonyms |
| Description | Corticosterone is an adrenocortical steroid that has modest but significant activities as a mineralocorticoid and a glucocorticoid. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 529.2±50.0 °C at 760 mmHg |
| Melting Point | 179-183 °C(lit.) |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.461 |
| Flash Point | 288.0±26.6 °C |
| Exact Mass | 346.214417 |
| PSA | 74.60000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | OMFXVFTZEKFJBZ-HJTSIMOOSA-N |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C(C(=O)CO)CCC12 |
| Storage condition | Store at RT |
| Stability | Stable, but light sensitive. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Precursor 10 | |
|---|---|
| DownStream 6 | |
|
Preventing leptin resistance by blocking angiotensin II AT1 receptors in diet-induced obese rats.
Br. J. Pharmacol. 172(3) , 857-68, (2015) AT1 receptor blockers (ARBs) represent an approach for treating metabolic syndrome due to their potency in reducing hypertension, body weight and onset of type 2 diabetes. The mechanism underlying ARB... |
|
|
Osteopontin deletion prevents the development of obesity and hepatic steatosis via impaired adipose tissue matrix remodeling and reduced inflammation and fibrosis in adipose tissue and liver in mice.
PLoS ONE 9(5) , e98398, (2014) Osteopontin (OPN) is a multifunctional extracellular matrix (ECM) protein involved in multiple physiological processes. OPN expression is dramatically increased in visceral adipose tissue in obesity a... |
|
|
Carotid body denervation prevents fasting hyperglycemia during chronic intermittent hypoxia.
J. Appl. Physiol. 117(7) , 765-76, (2014) Obstructive sleep apnea causes chronic intermittent hypoxia (IH) and is associated with impaired glucose metabolism, but mechanisms are unknown. Carotid bodies orchestrate physiological responses to h... |
| Pregn-4-ene-3,20-dione, 11β,21-dihydroxy- |
| CORTICOSTERONE |
| Pregn-4-ene-3,20-dione, 11β, 21-dihydroxy- |
| Pregn-4-ene-3,20-dione, 11,21-dihydroxy-, (11β)- |
| EINECS 200-019-6 |
| 4-Pregnene-11b,21-diol-3,20-dione |
| 11b,21-Dihydroxy-4-pregnene-3,20-dione |
| MFCD00037715 |
| (11β)-11,21-Dihydroxypregn-4-ene-3,20-dione |
| Pregn-4-ene-3,20-dione, 11,21-dihydroxy-, (11-β)- (9CI) |
| 11b,21-Dihydroxyprogesterone |
| (8S,9S,10R,11S,13S,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| (11b)-11,21-Dihydroxypregn-4-ene-3,20-dione |
| 11b,21-Dihydroxypregn-4-ene-3,20-dione |
| Pregn-4-ene-3,20-dione, 11-β,21-dihydroxy- |
| 4-08-00-02907 (Beilstein Handbook Reference) |
| 4-Pregnene-11β,21-diol-3,20-dione |