Polyphyllin B structure
|
Common Name | Polyphyllin B | ||
|---|---|---|---|---|
| CAS Number | 50773-42-7 | Molecular Weight | 1015.185 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C51H82O20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Polyphyllin BFormosanin C is a diosgenin saponin isolated from Paris formosana Hayata and an immunomodulator with antitumor activity. Formosanin C induces apoptosis[1][2]. |
| Name | diosgenin tetraglycoside |
|---|---|
| Synonym | More Synonyms |
| Description | Formosanin C is a diosgenin saponin isolated from Paris formosana Hayata and an immunomodulator with antitumor activity. Formosanin C induces apoptosis[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C51H82O20 |
| Molecular Weight | 1015.185 |
| Exact Mass | 1014.539917 |
| PSA | 294.60000 |
| LogP | 5.72 |
| Index of Refraction | 1.621 |
| InChIKey | OZIHYFWYFUSXIS-KORJSKJVSA-N |
| SMILES | CC1CCC2(OC1)OC1CC3C4CC=C5CC(OC6OC(CO)C(OC7OC(C)C(OC8OC(C)C(O)C(O)C8O)C(O)C7O)C(O)C6OC6OC(C)C(O)C(O)C6O)CCC5(C)C4CCC3(C)C1C2C |
| Storage condition | -20°C |
| formosanin C |
| Spirost-5-en-3-yl 6-deoxyhexopyranosyl-(1->2)-[6-deoxyhexopyranosyl-(1->4)-6-deoxyhexopyranosyl-(1->4)]hexopyranoside |
| Polyphyllin B (ForMosanin C) |
| PolyphyllinB |
| Hexopyranoside, spirost-5-en-3-yl O--6-deoxyhexopyranosyl-(1->2)-O-[O--6-deoxyhexopyranosyl-(1->4)-6-deoxyhexopyranosyl-(1->4)]- |
| Parissaponin Pb |
| Paris II |
| Parrisaponin |
| Asperin |
| Paris saponin II |
| Polyphyllin II |