H-D-Phe-Pro-OH trifluoroacetate salt structure
|
Common Name | H-D-Phe-Pro-OH trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 51926-52-4 | Molecular Weight | 262.30400 | |
| Density | 1.282g/cm3 | Boiling Point | 509.7ºC at 760mmHg | |
| Molecular Formula | C14H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.1ºC | |
| Name | (2S)-1-[(2R)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 509.7ºC at 760mmHg |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.30400 |
| Flash Point | 262.1ºC |
| Exact Mass | 262.13200 |
| PSA | 83.63000 |
| LogP | 1.27020 |
| Index of Refraction | 1.599 |
| InChIKey | WEQJQNWXCSUVMA-NEPJUHHUSA-N |
| SMILES | NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)O |
| HS Code | 2933990090 |
|---|
|
~%
H-D-Phe-Pro-OH ... CAS#:51926-52-4 |
| Literature: Synge Biochemical Journal, 1948 , vol. 42, p. 99,101 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-D-Phenylalanyl-L-proline |
| Phenylalanylproline |
| d-phenylalanyl-l-proline |
| D-Phe-pro |
| L-Proline,D-phenylalanyl |
| L-Phe-pro |