Sesamolin structure
|
Common Name | Sesamolin | ||
|---|---|---|---|---|
| CAS Number | 526-07-8 | Molecular Weight | 370.353 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 520.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H18O7 | Melting Point | 93 - 94ºC (Decomposes) | |
| MSDS | N/A | Flash Point | 219.2±30.0 °C | |
Use of SesamolinSesaminol, isolated from Justicia orbiculata, has antioxidative activity, Sesaminol inhibits lipid peroxidation and shows neuroprotection effect. Sesaminol potently inhibits MAPK cascades by preventing phosphorylation of JNK, p38 MAPKs, and caspase-3 but not ERK-MAPK expression[1][2][3][4]. |
| Name | sesamolin |
|---|---|
| Synonym | More Synonyms |
| Description | Sesaminol, isolated from Justicia orbiculata, has antioxidative activity, Sesaminol inhibits lipid peroxidation and shows neuroprotection effect. Sesaminol potently inhibits MAPK cascades by preventing phosphorylation of JNK, p38 MAPKs, and caspase-3 but not ERK-MAPK expression[1][2][3][4]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 520.8±50.0 °C at 760 mmHg |
| Melting Point | 93 - 94ºC (Decomposes) |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.353 |
| Flash Point | 219.2±30.0 °C |
| Exact Mass | 370.105255 |
| PSA | 64.61000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | ZZMNWJVJUKMZJY-AFHBHXEDSA-N |
| SMILES | c1cc2c(cc1OC1OCC3C(c4ccc5c(c4)OCO5)OCC13)OCO2 |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3.0 |
| HS Code | 29329990 |
| 5-[(1S,3aR,4R,6aR)-4-(1,3-Benzodioxol-5-yloxy)tetrahydro-1H,3H-furo[3,4-c]fur-1-yl]-1,3-benzodioxol |
| 5-[(1S,3aR,4R,6aR)-4-(2H-1,3-benzodioxol-5-yloxy)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2H-1,3-benzodioxole |
| Sesamolin |
| 5-[(1S,3aR,4R,6aR)-4-(1,3-Benzodioxol-5-yloxy)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-1,3-benzodioxole |
| (1S,3aR,4R,6aR)-5-[4-(1,3-benzodioxol-5-yloxy)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-1,3-benzodioxole |
| 5-[4-(1,3-Benzodioxolol-5-yloxy)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-1,3-benzodioxole |
| 1,3-Benzodioxole, 5-[(1S,3aR,4R,6aR)-4-(1,3-benzodioxol-5-yloxy)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]- |
| 1,3-benzodioxol-5-yl (1R,3aR,4S,6aR)-4-(1,3-benzodioxol-5-yl)perhydrofuro[3,4-c]furan-1-yl ether |