4'-Hydroxy Flurbiprofen structure
|
Common Name | 4'-Hydroxy Flurbiprofen | ||
|---|---|---|---|---|
| CAS Number | 52807-12-2 | Molecular Weight | 260.26000 | |
| Density | 1.288g/cm3 | Boiling Point | 417.6ºC at 760 mmHg | |
| Molecular Formula | C15H13FO3 | Melting Point | 177-178ºC | |
| MSDS | N/A | Flash Point | 206.3ºC | |
Use of 4'-Hydroxy Flurbiprofen4'-hydroxy Flurbiprofen is a major active metabolite of the COX inhibitor flurbiprofen and its enantiomers (R)-flurbiprofen and (S)-flurbiprofen. |
| Name | 4'-Hydroxy Flurbiprofen |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 417.6ºC at 760 mmHg |
| Melting Point | 177-178ºC |
| Molecular Formula | C15H13FO3 |
| Molecular Weight | 260.26000 |
| Flash Point | 206.3ºC |
| Exact Mass | 260.08500 |
| PSA | 57.53000 |
| LogP | 3.38640 |
| Index of Refraction | 1.593 |
| InChIKey | GTSMMBJBNJDFRA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1ccc(-c2ccc(O)cc2)c(F)c1 |
| HS Code | 2922299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-Hydroxy Flurbiprofen |
| 2-(4'-Hydroxy-2-fluoro-4-biphenylyl)propionic Acid |
| 2-(2-fluoro-4'-hydroxybiphenyl-4-yl)propanoic acid |
| 2-(2-fluoro-4'-hydroxy-4-biphenylyl)propionic acid |
| FPH |
| 2-(2-fluoro-4'-hydroxy-biphenyl-4-yl)-propionic acid |
| Flurbiprofen EP Impurity G |