Benzaldehyde,4-(benzoyloxy)- structure
|
Common Name | Benzaldehyde,4-(benzoyloxy)- | ||
|---|---|---|---|---|
| CAS Number | 5339-06-0 | Molecular Weight | 226.22700 | |
| Density | 1.226g/cm3 | Boiling Point | 380.8ºC at 760mmHg | |
| Molecular Formula | C14H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.5ºC | |
| Name | (4-formylphenyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 380.8ºC at 760mmHg |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.22700 |
| Flash Point | 170.5ºC |
| Exact Mass | 226.06300 |
| PSA | 43.37000 |
| LogP | 2.71830 |
| Index of Refraction | 1.618 |
| InChIKey | KYZWJGYDXCOKRS-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(OC(=O)c2ccccc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916310090 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 4-Benzoyloxy-benzaldehyd |
| benzoic acid 4-formylphenyl ester |