2-Propenoic acid,3-(3,4-dimethoxyphenyl)-, methyl ester structure
|
Common Name | 2-Propenoic acid,3-(3,4-dimethoxyphenyl)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 5396-64-5 | Molecular Weight | 222.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-Propenoic acid,3-(3,4-dimethoxyphenyl)-, methyl esterMethyl 3,4-dimethoxycinnamate is an inhibitor of uredospore germination. Methyl 3,4-dimethoxycinnamate also inhibits global DNA methylation in in Hep3B cells[1][2]. |
| Name | methyl-3,4-dimethoxycinnamate |
|---|---|
| Synonym | More Synonyms |
| Description | Methyl 3,4-dimethoxycinnamate is an inhibitor of uredospore germination. Methyl 3,4-dimethoxycinnamate also inhibits global DNA methylation in in Hep3B cells[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H14O4 |
|---|---|
| Molecular Weight | 222.24 |
| Exact Mass | 222.08900 |
| PSA | 44.76000 |
| LogP | 1.89000 |
| InChIKey | JXRYDOZRPYFBKO-FNORWQNLSA-N |
| SMILES | COC(=O)C=Cc1ccc(OC)c(OC)c1 |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl 3,4-dimethoxycinnamate |
| 3-(3,4-dimethoxyphenyl)-acrylic acid methyl ester |
| methyl (2E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| methyl 3-(3,4-dimethoxyphenyl)-2-propenoate |
| 2-Propenoic acid,3-(3,4-dimethoxyphenyl)-,methyl ester |
| 3,4-O-Dimethylcaffeic acid methyl ester |
| methyl (E)-3,4-dimethoxycinnamate |
| Cinnamic acid,3,4-dimethoxy-,methyl ester |
| 2-Propenoic acid,3-(3,4-dimethoxyphenyl)-,methyl ester,trans |
| 3-(3',4'-dimethoxyphenyl)-(E)-propenoic acid methyl ester |
| Methyl 3-(3`,4`-Dimethoxyphenyl)propenoate |
| ferulic methyl ester |