DB04760 structure
|
Common Name | DB04760 | ||
|---|---|---|---|---|
| CAS Number | 544678-85-5 | Molecular Weight | 410.41700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H20F2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DB04760DB04760 (compound 4) is a potent, highly selective, non-zinc-chelating MMP-13 inhibitor with an IC50 of 8 nM[1]. DB04760 significantly reduces paclitaxel neurotoxicity and has anticancer activity[2]. |
| Name | pyrimidine-4,6-dicarboxylic acid bis-(4-fluoro-3-methyl-benzylamide) |
|---|---|
| Synonym | More Synonyms |
| Description | DB04760 (compound 4) is a potent, highly selective, non-zinc-chelating MMP-13 inhibitor with an IC50 of 8 nM[1]. DB04760 significantly reduces paclitaxel neurotoxicity and has anticancer activity[2]. |
|---|---|
| Related Catalog | |
| Target |
MMP-13:8 nM (IC50) |
| References |
| Molecular Formula | C22H20F2N4O2 |
|---|---|
| Molecular Weight | 410.41700 |
| Exact Mass | 410.15500 |
| PSA | 83.98000 |
| LogP | 4.01340 |
| InChIKey | PYFRREJCFXFNRR-UHFFFAOYSA-N |
| SMILES | Cc1cc(CNC(=O)c2cc(C(=O)NCc3ccc(F)c(C)c3)ncn2)ccc1F |
| MMP-13 INHIBITOR |
| N4,N6-Bis(4-fluoro-3-methylbenzyl)pyrimidine-4,6-dicarboxamide |