Benzenepropanoic acid, a,b-dibromo-, ethyl ester structure
|
Common Name | Benzenepropanoic acid, a,b-dibromo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5464-70-0 | Molecular Weight | 336.02000 | |
| Density | 1.657 g/cm3 | Boiling Point | 317.3ºC at 760 mmHg | |
| Molecular Formula | C11H12Br2O2 | Melting Point | 77-79°C | |
| MSDS | N/A | Flash Point | 145.7ºC | |
| Name | ethyl 2,3-dibromo-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.657 g/cm3 |
|---|---|
| Boiling Point | 317.3ºC at 760 mmHg |
| Melting Point | 77-79°C |
| Molecular Formula | C11H12Br2O2 |
| Molecular Weight | 336.02000 |
| Flash Point | 145.7ºC |
| Exact Mass | 333.92000 |
| PSA | 26.30000 |
| LogP | 3.44920 |
| Index of Refraction | 1.574 |
| InChIKey | CCYOCUPSKJUNMD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Br)C(Br)c1ccccc1 |
| Storage condition | 2-8°C |
| Hazard Codes | C |
|---|---|
| Risk Phrases | R34:Causes burns. R37:Irritating to the respiratory system. |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2916399090 |
|
~99%
Benzenepropanoi... CAS#:5464-70-0 |
| Literature: Pereira; Savage; Simpson Synthetic Communications, 1995 , vol. 25, # 7 p. 1023 - 1026 |
|
~83%
Benzenepropanoi... CAS#:5464-70-0 |
| Literature: Kabalka; Yang; Reddy; Narayana Synthetic Communications, 1998 , vol. 28, # 5 p. 925 - 929 |
|
~%
Benzenepropanoi... CAS#:5464-70-0 |
| Literature: Journal of the Chemical Society, , vol. 83, p. 673 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00017860 |
| Ethyl 2,3-Dibromo-3-phenylpropionate |
| ethyl2,3-dibromo-3-phenylpropanoate |
| 2,3,5,6-TETRAFLUOROBENZYLCHLORIDE |
| 2,3-dibromo-3-phenylpropionic acid ethyl ester |
| 2,3-Dibrom-3-phenyl-propionsaeure-aethylester |