N-(4-Chloro-3-nitrophenyl)acetamide structure
|
Common Name | N-(4-Chloro-3-nitrophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 5540-60-3 | Molecular Weight | 214.60600 | |
| Density | 1.466g/cm3 | Boiling Point | 404.1ºC at 760mmHg | |
| Molecular Formula | C8H7ClN2O3 | Melting Point | 125-129ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-Chloro-3-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 404.1ºC at 760mmHg |
| Melting Point | 125-129ºC |
| Molecular Formula | C8H7ClN2O3 |
| Molecular Weight | 214.60600 |
| Exact Mass | 214.01500 |
| PSA | 88.91000 |
| LogP | 2.49950 |
| Index of Refraction | 1.778 |
| InChIKey | QUMQBQADXFETJW-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2924299090 |
|
~99%
N-(4-Chloro-3-n... CAS#:5540-60-3 |
| Literature: Martin, Richard; Flatt, Brenton Todd; Kahl, Jeffrey Dean; Wang, Tie-Lin Patent: US2003/212111 A1, 2003 ; US 20030212111 A1 |
|
~95%
N-(4-Chloro-3-n... CAS#:5540-60-3 |
| Literature: Meshram, Gangadhar; Patil, Vishvanath D. Synthetic Communications, 2009 , vol. 39, # 24 p. 4384 - 4395 |
|
~9%
N-(4-Chloro-3-n... CAS#:5540-60-3 |
| Literature: Australian Journal of Chemistry, , vol. 38, # 5 p. 723 - 733 |
|
~8%
N-(4-Chloro-3-n... CAS#:5540-60-3 |
| Literature: Australian Journal of Chemistry, , vol. 38, # 5 p. 723 - 733 |
|
~%
N-(4-Chloro-3-n... CAS#:5540-60-3 |
| Literature: Chemische Berichte, , vol. 33, p. 3062 |
|
~%
N-(4-Chloro-3-n... CAS#:5540-60-3 |
| Literature: Chemische Berichte, , vol. 33, p. 3062 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00017143 |
| 4-chloro-3-nitroacetanilide |
| 3NC |
| 3-Nitro-4-chlor-acetanilid |
| 3-NITRO-4-CHLOROACETANILIDE |
| M-NITRO-P-CHLORO ACETANILIDE |
| acetic acid-(4-chloro-3-nitro-anilide) |
| Essigsaeure-(4-chlor-3-nitro-anilid) |
| 4-CHLORO-3-NITROPHENYLACETAMIDE |
| A-(4-CHLORO-3-NITROPHENYL)ACETAMIDE |
| 4-Chlor-3-nitro-acetanilid |
| EINECS 226-904-7 |
| 2-(4-Chloro-3-nitrophenyl)acetamide |