LY 116467
Modify Date: 2025-08-26 10:32:10
LY 116467 structure
|
Common Name | LY 116467 | ||
|---|---|---|---|---|
| CAS Number | 57202-76-3 | Molecular Weight | 286.43500 | |
| Density | 1.29g/cm3 | Boiling Point | 434ºC at 760mmHg | |
| Molecular Formula | C17H22N2S | Melting Point | >256ºC (dec.) | |
| MSDS | N/A | Flash Point | 216.3ºC | |
Use of LY 116467LY 116467 is a dopamine agonist. LY116467 increases serum corticosterone concentration in rats at a dose of 3 mg/kg. |
| Name | 6-Methyl Pergolide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 434ºC at 760mmHg |
| Melting Point | >256ºC (dec.) |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.43500 |
| Flash Point | 216.3ºC |
| Exact Mass | 286.15000 |
| PSA | 44.33000 |
| LogP | 3.42880 |
| Index of Refraction | 1.699 |
| InChIKey | HEZLHSNBFOCKCQ-UHFFFAOYSA-N |
| SMILES | CSCC1CC2c3cccc4[nH]cc(c34)CC2N(C)C1 |
| (6aR,9R,10aR)-7-methyl-9-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |