Benzyl 1H-benzotriazole-1-carboxylate structure
|
Common Name | Benzyl 1H-benzotriazole-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 57710-80-2 | Molecular Weight | 253.256 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 427.3±38.0 °C at 760 mmHg | |
| Molecular Formula | C14H11N3O2 | Melting Point | 107-109ºC | |
| MSDS | N/A | Flash Point | 212.2±26.8 °C | |
| Name | benzyl benzotriazole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 427.3±38.0 °C at 760 mmHg |
| Melting Point | 107-109ºC |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.256 |
| Flash Point | 212.2±26.8 °C |
| Exact Mass | 253.085129 |
| PSA | 57.01000 |
| LogP | 3.11 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | OEFZXDSNQGIDHW-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)n1nnc2ccccc21 |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
|
~92%
Benzyl 1H-benzo... CAS#:57710-80-2 |
| Literature: Wuensch, E.; Graf, W.; Keller, O.; Keller, W.; Wersin, G. Synthesis, 1986 , # 11 p. 958 - 960 |
|
~96%
Benzyl 1H-benzo... CAS#:57710-80-2 |
| Literature: Katritzky, Alan R.; Zhang, Gui-Fen; Fan, Wei-Qiang; Wu, Jing; Pernak, Juliusz Journal of Physical Organic Chemistry, 1993 , vol. 6, # 10 p. 567 - 573 |
|
~%
Benzyl 1H-benzo... CAS#:57710-80-2 |
| Literature: Katritzky, Alan R.; Zhang, Gui-Fen; Fan, Wei-Qiang; Wu, Jing; Pernak, Juliusz Journal of Physical Organic Chemistry, 1993 , vol. 6, # 10 p. 567 - 573 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| Benzyl 1-benzotriazolecarboxylate |
| N-CBz-benzotriazole |
| benzotriazol-1-yl benzyl carbonate |
| phenylmethyl benzotriazolecarboxylate |
| Benzyl 1H-benzotriazole-1-carboxylate |
| Z-benzotriazole |
| 1H-1,2,3-Benzotriazole-1-carboxylic acid, phenylmethyl ester |
| N-Cbz-1H-benzotriazole |
| benzotriazole-1-carboxylic acid benzyl ester |