Met-Enkephalin acetate salt structure
|
Common Name | Met-Enkephalin acetate salt | ||
|---|---|---|---|---|
| CAS Number | 58569-55-4 | Molecular Weight | 573.66100 | |
| Density | 1.324 g/cm3 | Boiling Point | 1052.9ºC at 760 mmHg | |
| Molecular Formula | C27H35N5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 590.6ºC | |
Use of Met-Enkephalin acetate saltTyr-Gly-Gly-Phe-Met-OH regulates human immune function and inhibits tumor growth via binding to the opioid receptor. |
| Name | 2-[[2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Tyr-Gly-Gly-Phe-Met-OH regulates human immune function and inhibits tumor growth via binding to the opioid receptor. |
|---|---|
| Related Catalog | |
| Target |
Opioid Receptor[1]. |
| In Vitro | Methionine enkephalin (MENK), an endogenous neuropeptide has a crucial role in both neuroendocrine and immune systems. MENK is believed to have an immunoregulatory activity to have cancer biotherapy activity by binding to the opioid receptors on immune and cancer cells. MENK may also change the tumor microenvironment by binding to opioid receptor on or in cancer cells. All of these mechanisms of action have biologic significance and potential for use in cancer immunotherapy. Furthermore, they reveal a relationship between the endocrine and immune systems[1]. |
| References |
| Density | 1.324 g/cm3 |
|---|---|
| Boiling Point | 1052.9ºC at 760 mmHg |
| Molecular Formula | C27H35N5O7S |
| Molecular Weight | 573.66100 |
| Flash Point | 590.6ºC |
| Exact Mass | 573.22600 |
| PSA | 225.25000 |
| LogP | 1.80830 |
| Index of Refraction | 1.608 |
| InChIKey | YFGBQHOOROIVKG-FKBYEOEOSA-N |
| SMILES | CSCCC(NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| Storage condition | −20°C |
| Safety Phrases | S22-S24/25 |
|---|---|
| WGK Germany | 3 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| MET-enkephalin |
| ENKEPHALIN,METHIONINE |
| 1-5-Adrenorphin (human) |
| H-Tyr(1)-Gly(2)-Gly(3)-Phe(4)-Met(5)-OH |
| Methionine enkephalin |
| [Met5]-enkephalin |
| TYR-GLY-GLY-PHE-MET |
| Opioid growth factor |
| H-Tyr-Gly-Gly-Phe-Met-OH |
| EINECS 261-335-8 |
| Tyr-Gly-Gly-Phe-Met-OH |
| Lupex |