3-Nitrophthalimide structure
|
Common Name | 3-Nitrophthalimide | ||
|---|---|---|---|---|
| CAS Number | 603-62-3 | Molecular Weight | 192.128 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H4N2O4 | Melting Point | 213-215 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-Nitrophthalimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Melting Point | 213-215 °C(lit.) |
| Molecular Formula | C8H4N2O4 |
| Molecular Weight | 192.128 |
| Exact Mass | 192.017105 |
| PSA | 91.99000 |
| LogP | 0.88 |
| Index of Refraction | 1.658 |
| InChIKey | BONIIQYTWOPUQI-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)c2c1cccc2[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925190090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Fluorescent markers of hypoxic cells: a comparison of two compounds on three cell lines.
Br. J. Radiol. 58(691) , 645-54, (1985) Two compounds, nitroakridin 3582 (NA) and a 3-nitro-naphthalimide (DM113), have been tested as potential fluorescent markers for hypoxic cells. Cellular fluorescence in three cell lines (V79-379A, WHF... |
| EINECS 210-051-2 |
| 4-nitroisoindole-1,3-dione |
| 1H-Isoindole-1,3(2H)-dione, 4-nitro- |
| 4-Nitro-1H-isoindole-1,3(2H)-dione |
| 3-Nitrophthalimide |
| MFCD00041852 |