2-NITROPHENYL ACETATE structure
|
Common Name | 2-NITROPHENYL ACETATE | ||
|---|---|---|---|---|
| CAS Number | 610-69-5 | Molecular Weight | 181.14500 | |
| Density | 1.304g/cm3 | Boiling Point | 141ºC/11 mmHg(lit.) | |
| Molecular Formula | C8H7NO4 | Melting Point | 39-41ºC(lit.) | |
| MSDS | N/A | Flash Point | 113ºC | |
| Name | (2-nitrophenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 141ºC/11 mmHg(lit.) |
| Melting Point | 39-41ºC(lit.) |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.14500 |
| Flash Point | 113ºC |
| Exact Mass | 181.03800 |
| PSA | 72.12000 |
| LogP | 2.04330 |
| Index of Refraction | 1.548 |
| InChIKey | MRCKRGSNLOHYRA-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccccc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S22-S24/25 |
| HS Code | 2915390090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 2-nitrobenzyl acetate |
| Acetic acid,2-nitrophenyl ester |
| Acetic acid,o-nitrophenyl ester |
| 2-nitrophenyl acetate |
| Nitrophenyl Acetate |
| 2-Nitrophenol acetate |
| o-Nitrophenyl acetate |