4-Hydroxy-3-Nitroacetophenone structure
|
Common Name | 4-Hydroxy-3-Nitroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 6322-56-1 | Molecular Weight | 181.145 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 282.7±20.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | 132-135 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 124.5±10.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4'-Hydroxy-3'-nitroacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 282.7±20.0 °C at 760 mmHg |
| Melting Point | 132-135 °C(lit.) |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.145 |
| Flash Point | 124.5±10.2 °C |
| Exact Mass | 181.037506 |
| PSA | 83.12000 |
| LogP | 1.75 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | MMNKVWGVSHRIJL-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD00017002 |
| 4-Hydroxy-3-Nitroacetophenone |
| 1-(4-Hydroxy-3-nitrophenyl)ethanone |
| Ethanone, 1-(4-hydroxy-3-nitrophenyl)- |
| 4'-Hydroxy-3'-nitroacetophenone |