4-METHYL-3-NITROBENZENESULFONYL CHLORIDE structure
|
Common Name | 4-METHYL-3-NITROBENZENESULFONYL CHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 616-83-1 | Molecular Weight | 235.64500 | |
| Density | 1.528g/cm3 | Boiling Point | 152-154°C 1mm | |
| Molecular Formula | C7H6ClNO4S | Melting Point | 30-34 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4-Methyl-3-nitrobenzene-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.528g/cm3 |
|---|---|
| Boiling Point | 152-154°C 1mm |
| Melting Point | 30-34 °C(lit.) |
| Molecular Formula | C7H6ClNO4S |
| Molecular Weight | 235.64500 |
| Flash Point | >230 °F |
| Exact Mass | 234.97100 |
| PSA | 88.34000 |
| LogP | 3.43470 |
| Index of Refraction | 1.576 |
| InChIKey | OQFYBGANSUNUAO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Cl)cc1[N+](=O)[O-] |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R14;R29;R34 |
| Safety Phrases | S26-S36/37/39-S45-S8-S30-S22 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
|
~86%
4-METHYL-3-NITR... CAS#:616-83-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 10, # 6 p. 1841 - 1854 |
|
~%
4-METHYL-3-NITR... CAS#:616-83-1 |
| Literature: US5136043 A1, ; |
|
~88%
4-METHYL-3-NITR... CAS#:616-83-1 |
| Literature: Journal of Organic Chemistry, , vol. 56, # 14 p. 4576 - 4579 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00129811 |
| 4-methyl-3-nitrobenzenesulfonyl chloride |