Benzene,1-(dibromomethyl)-4-nitro structure
|
Common Name | Benzene,1-(dibromomethyl)-4-nitro | ||
|---|---|---|---|---|
| CAS Number | 619-75-0 | Molecular Weight | 294.92800 | |
| Density | 2.038g/cm3 | Boiling Point | 334.2ºC at 760 mmHg | |
| Molecular Formula | C7H5Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.9ºC | |
| Name | 1-(dibromomethyl)-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.038g/cm3 |
|---|---|
| Boiling Point | 334.2ºC at 760 mmHg |
| Molecular Formula | C7H5Br2NO2 |
| Molecular Weight | 294.92800 |
| Flash Point | 155.9ºC |
| Exact Mass | 292.86900 |
| PSA | 45.82000 |
| LogP | 3.90640 |
| Index of Refraction | 1.656 |
| InChIKey | MKHFRSNFHCJQIQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(Br)Br)cc1 |
| HS Code | 2904909090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| p-dibromomethylnitrobenzene |
| Benzene,1-(dibromomethyl)-4-nitro |
| 1-dibromomethyl-4-nitro-benzene |
| p-Nitrobenzal bromide |
| 4-nitrobenzylidene dibromide |
| 4-nitrobenzyl bromide |
| p-nitrobenzylidene dibromide |
| p-Nitrobenzylidene bromide |
| 4-nitrobenzylidene bromide |
| 4-nitrobenzal bromide |