2-(4-nitrobenzyl)-1H-isoindole-1,3(2H)-dione structure
|
Common Name | 2-(4-nitrobenzyl)-1H-isoindole-1,3(2H)-dione | ||
|---|---|---|---|---|
| CAS Number | 62133-07-7 | Molecular Weight | 282.25100 | |
| Density | 1.464g/cm3 | Boiling Point | 484.3ºC at 760 mmHg | |
| Molecular Formula | C15H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.7ºC | |
| Name | 2-[(4-nitrophenyl)methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 484.3ºC at 760 mmHg |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.25100 |
| Flash Point | 246.7ºC |
| Exact Mass | 282.06400 |
| PSA | 83.20000 |
| LogP | 2.85210 |
| Index of Refraction | 1.686 |
| InChIKey | QKWWUOQTLINZES-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2925190090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(4-Nitrobenzyl)isoindole-1,3-dione |
| 2-[(4-nitrophenyl)methyl]benzo[c]azolidine-1,3-dione |
| N-(para-nitrobenzyl)-phthalimide |
| 2-(4-nitrobenzyl)isoindoline-1,3-dione |
| N-(p-Nitrobenzyl)phthalimide |
| 2-(4-nitrobenzyl)-1H-isoindole-1,3(2H)-dione |
| p-nitrobenzylphthalimide |
| N-(4-nitro-benzyl)-phthalimide |