Xanthoangelol structure
|
Common Name | Xanthoangelol | ||
|---|---|---|---|---|
| CAS Number | 62949-76-2 | Molecular Weight | 392.48700 | |
| Density | 1.165g/cm3 | Boiling Point | 605.8ºC at 760 mmHg | |
| Molecular Formula | C25H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.2ºC | |
Use of XanthoangelolXanthoangelol, extracted from Angelica keiskei, suppresses obesity-induced inflammatory responses. Xanthoangelol possesses antibacterial activity[1][2]. Xanthoangelol and inhibits monoamine oxidases[3]. Xanthoangelol induces apoptosis in neuroblastoma and leukemia cells[4]. |
| Name | (E)-1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Xanthoangelol, extracted from Angelica keiskei, suppresses obesity-induced inflammatory responses. Xanthoangelol possesses antibacterial activity[1][2]. Xanthoangelol and inhibits monoamine oxidases[3]. Xanthoangelol induces apoptosis in neuroblastoma and leukemia cells[4]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 605.8ºC at 760 mmHg |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.48700 |
| Flash Point | 334.2ºC |
| Exact Mass | 392.19900 |
| PSA | 77.76000 |
| LogP | 5.93470 |
| Index of Refraction | 1.625 |
| InChIKey | LRSMBOSQWGHYCW-MDGZPELGSA-N |
| SMILES | CC(C)=CCCC(C)=CCc1c(O)ccc(C(=O)C=Cc2ccc(O)cc2)c1O |
| Xanthoangelol |
| xanthoangerol |
| 2',4,4'-trihydroxy-3'-geranylchalcone |
| 3-geranyl-2,4,4'-trihydroxychalcone |